C16H18N2O3S2 — CID 1077847
N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-thiophen-2-ylacetamide (PubChem CID 1077847) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.47 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-thiophen-2-ylacetamide.
| Compound Name | N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 1077847 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C16H18N2O3S2/c19-16(12-14-4-3-11-22-14)17-13-5-7-15(8-6-13)23(20,21)18-9-1-2-10-18/h3-8,11H,1-2,9-10,12H2,(H,17,19) |
| InChIKey | ZMYUHWNQSIRLEL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |