C11H11N3O4S2 — CID 107785539
5-methyl-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophene-2-carboxylic acid (PubChem CID 107785539) has the molecular formula C11H11N3O4S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-methyl-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophene-2-carboxylic acid.
| Compound Name | 5-methyl-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 107785539 |
| Molecular Formula | C11H11N3O4S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 5-methyl-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophene-2-carboxylic acid |
| SMILES | Cc1sc(C(=O)O)cc1CSc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C11H11N3O4S2/c1-5-6(3-7(20-5)10(17)18)4-19-11-12-8(15)9(16)13-14(11)2/h3H,4H2,1-2H3,(H,13,16)(H,17,18) |
| InChIKey | RMBHQXOIAFUJBS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|