C8H12BrN3O2S — CID 107785570
3-(4-bromobutylsulfanyl)-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107785570) has the molecular formula C8H12BrN3O2S and a molecular weight of 294.17 g/mol. Its IUPAC name is 3-(4-bromobutylsulfanyl)-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-(4-bromobutylsulfanyl)-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107785570 |
| Molecular Formula | C8H12BrN3O2S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 3-(4-bromobutylsulfanyl)-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCCCCBr |
| InChI | InChI=1S/C8H12BrN3O2S/c1-12-8(15-5-3-2-4-9)10-6(13)7(14)11-12/h2-5H2,1H3,(H,11,14) |
| InChIKey | RPFIRUFPCOLEKD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|