C11H9FN4O4S — CID 107785608
3-[(3-fluoro-4-nitrophenyl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107785608) has the molecular formula C11H9FN4O4S and a molecular weight of 312.28 g/mol. Its IUPAC name is 3-[(3-fluoro-4-nitrophenyl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[(3-fluoro-4-nitrophenyl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107785608 |
| Molecular Formula | C11H9FN4O4S |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 3-[(3-fluoro-4-nitrophenyl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCc1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C11H9FN4O4S/c1-15-11(13-9(17)10(18)14-15)21-5-6-2-3-8(16(19)20)7(12)4-6/h2-4H,5H2,1H3,(H,14,18) |
| InChIKey | UTQJQNQIZDAUIG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|