C11H9F3N4O2S — CID 107785702
3-[4-amino-2-(trifluoromethyl)phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107785702) has the molecular formula C11H9F3N4O2S and a molecular weight of 318.28 g/mol. Its IUPAC name is 3-[4-amino-2-(trifluoromethyl)phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[4-amino-2-(trifluoromethyl)phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107785702 |
| Molecular Formula | C11H9F3N4O2S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 3-[4-amino-2-(trifluoromethyl)phenyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1Sc1ccc(N)cc1C(F)(F)F |
| InChI | InChI=1S/C11H9F3N4O2S/c1-18-10(16-8(19)9(20)17-18)21-7-3-2-5(15)4-6(7)11(12,13)14/h2-4H,15H2,1H3,(H,17,20) |
| InChIKey | HCGNIXGFOOOARP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|