C12H12N4O4S — CID 107785713
2-amino-3-methyl-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzoic acid (PubChem CID 107785713) has the molecular formula C12H12N4O4S and a molecular weight of 308.32 g/mol. Its IUPAC name is 2-amino-3-methyl-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzoic acid.
| Compound Name | 2-amino-3-methyl-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzoic acid |
|---|---|
| PubChem CID | 107785713 |
| Molecular Formula | C12H12N4O4S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-amino-3-methyl-5-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]benzoic acid |
| SMILES | Cc1cc(Sc2nc(=O)c(=O)[nH]n2C)cc(C(=O)O)c1N |
| InChI | InChI=1S/C12H12N4O4S/c1-5-3-6(4-7(8(5)13)11(19)20)21-12-14-9(17)10(18)15-16(12)2/h3-4H,13H2,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | XJLVGXJMZKGBRA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 131.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|