C7H9F3N4O2S — CID 107785847
3-(3-amino-1,1,1-trifluoropropan-2-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107785847) has the molecular formula C7H9F3N4O2S and a molecular weight of 270.24 g/mol. Its IUPAC name is 3-(3-amino-1,1,1-trifluoropropan-2-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-(3-amino-1,1,1-trifluoropropan-2-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107785847 |
| Molecular Formula | C7H9F3N4O2S |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3-(3-amino-1,1,1-trifluoropropan-2-yl)sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SC(CN)C(F)(F)F |
| InChI | InChI=1S/C7H9F3N4O2S/c1-14-6(12-4(15)5(16)13-14)17-3(2-11)7(8,9)10/h3H,2,11H2,1H3,(H,13,16) |
| InChIKey | WDEKAYLSRFCMBV-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|