C12H16N4O2S — CID 107785929
4-methyl-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]cyclohexane-1-carbonitrile (PubChem CID 107785929) has the molecular formula C12H16N4O2S and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-methyl-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]cyclohexane-1-carbonitrile.
| Compound Name | 4-methyl-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 107785929 |
| Molecular Formula | C12H16N4O2S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-methyl-2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]cyclohexane-1-carbonitrile |
| SMILES | CC1CCC(C#N)C(Sc2nc(=O)c(=O)[nH]n2C)C1 |
| InChI | InChI=1S/C12H16N4O2S/c1-7-3-4-8(6-13)9(5-7)19-12-14-10(17)11(18)15-16(12)2/h7-9H,3-5H2,1-2H3,(H,15,18) |
| InChIKey | MMVKXLVACHCOQY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|