C8H13N3O3S — CID 107786256
3-(3-hydroxybutylsulfanyl)-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786256) has the molecular formula C8H13N3O3S and a molecular weight of 231.28 g/mol. Its IUPAC name is 3-(3-hydroxybutylsulfanyl)-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-(3-hydroxybutylsulfanyl)-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786256 |
| Molecular Formula | C8H13N3O3S |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 3-(3-hydroxybutylsulfanyl)-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | CC(O)CCSc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C8H13N3O3S/c1-5(12)3-4-15-8-9-6(13)7(14)10-11(8)2/h5,12H,3-4H2,1-2H3,(H,10,14) |
| InChIKey | JLWLGCWEHVQBRV-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|