C7H11N3O3S — CID 107786260
3-[(2S)-2-hydroxypropyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786260) has the molecular formula C7H11N3O3S and a molecular weight of 217.25 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxypropyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[(2S)-2-hydroxypropyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786260 |
| Molecular Formula | C7H11N3O3S |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 3-[(2S)-2-hydroxypropyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | C[C@H](O)CSc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C7H11N3O3S/c1-4(11)3-14-7-8-5(12)6(13)9-10(7)2/h4,11H,3H2,1-2H3,(H,9,13)/t4-/m0/s1 |
| InChIKey | QHXSCSHUAHVOBQ-BYPYZUCNSA-N |
| XLogP | -1.06 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|