C10H15N3O3S — CID 107786268
3-[(1R,2R)-2-hydroxycyclohexyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786268) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 3-[(1R,2R)-2-hydroxycyclohexyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[(1R,2R)-2-hydroxycyclohexyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786268 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 3-[(1R,2R)-2-hydroxycyclohexyl]sulfanyl-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1S[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C10H15N3O3S/c1-13-10(11-8(15)9(16)12-13)17-7-5-3-2-4-6(7)14/h6-7,14H,2-5H2,1H3,(H,12,16)/t6-,7-/m1/s1 |
| InChIKey | OUYGSRRSXSLKNI-RNFRBKRXSA-N |
| XLogP | -0.14 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|