C13H13N3O3S2 — CID 107786479
3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786479) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786479 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 3-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCc1cc(C#CCCO)cs1 |
| InChI | InChI=1S/C13H13N3O3S2/c1-16-13(14-11(18)12(19)15-16)21-8-10-6-9(7-20-10)4-2-3-5-17/h6-7,17H,3,5,8H2,1H3,(H,15,19) |
| InChIKey | RHDPQOVORIIDEB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|