C12H11N3O3S2 — CID 107786480
3-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786480) has the molecular formula C12H11N3O3S2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786480 |
| Molecular Formula | C12H11N3O3S2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 3-[[4-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCc1cc(C#CCO)cs1 |
| InChI | InChI=1S/C12H11N3O3S2/c1-15-12(13-10(17)11(18)14-15)20-7-9-5-8(6-19-9)3-2-4-16/h5-6,16H,4,7H2,1H3,(H,14,18) |
| InChIKey | LMEMPSKUBYUNPE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|