C12H11N3O4S2 — CID 107786481
(E)-3-[2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 107786481) has the molecular formula C12H11N3O4S2 and a molecular weight of 325.37 g/mol. Its IUPAC name is (E)-3-[2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107786481 |
| Molecular Formula | C12H11N3O4S2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | (E)-3-[2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanylmethyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCc1sccc1/C=C/C(=O)O |
| InChI | InChI=1S/C12H11N3O4S2/c1-15-12(13-10(18)11(19)14-15)21-6-8-7(4-5-20-8)2-3-9(16)17/h2-5H,6H2,1H3,(H,14,19)(H,16,17)/b3-2+ |
| InChIKey | LBLAPHXJBHNQHP-NSCUHMNNSA-N |
| XLogP | 0.92 |
| TPSA | 105.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|