C10H16N4O4S — CID 107786665
ethyl 2-amino-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanoate (PubChem CID 107786665) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is ethyl 2-amino-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanoate.
| Compound Name | ethyl 2-amino-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 107786665 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | ethyl 2-amino-4-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanoate |
| SMILES | CCOC(=O)C(N)CCSc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C10H16N4O4S/c1-3-18-9(17)6(11)4-5-19-10-12-7(15)8(16)13-14(10)2/h6H,3-5,11H2,1-2H3,(H,13,16) |
| InChIKey | BTOIOSNCJSMIKU-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|