C9H12N6O2S2 — CID 107786686
3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786686) has the molecular formula C9H12N6O2S2 and a molecular weight of 300.37 g/mol. Its IUPAC name is 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786686 |
| Molecular Formula | C9H12N6O2S2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 3-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | CCNc1nnc(CSc2nc(=O)c(=O)[nH]n2C)s1 |
| InChI | InChI=1S/C9H12N6O2S2/c1-3-10-8-13-12-5(19-8)4-18-9-11-6(16)7(17)14-15(9)2/h3-4H2,1-2H3,(H,10,13)(H,14,17) |
| InChIKey | JUOXECRTFIKONU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|