C10H14N6O2S2 — CID 107786687
2-methyl-3-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]methylsulfanyl]-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786687) has the molecular formula C10H14N6O2S2 and a molecular weight of 314.40 g/mol. Its IUPAC name is 2-methyl-3-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]methylsulfanyl]-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 2-methyl-3-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]methylsulfanyl]-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786687 |
| Molecular Formula | C10H14N6O2S2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-methyl-3-[[5-(propylamino)-1,3,4-thiadiazol-2-yl]methylsulfanyl]-1H-1,2,4-triazine-5,6-dione |
| SMILES | CCCNc1nnc(CSc2nc(=O)c(=O)[nH]n2C)s1 |
| InChI | InChI=1S/C10H14N6O2S2/c1-3-4-11-9-14-13-6(20-9)5-19-10-12-7(17)8(18)15-16(10)2/h3-5H2,1-2H3,(H,11,14)(H,15,18) |
| InChIKey | QQYQJWTZUMTWSE-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|