C7H8N6O2S2 — CID 107786722
3-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107786722) has the molecular formula C7H8N6O2S2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 3-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107786722 |
| Molecular Formula | C7H8N6O2S2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCc1nnc(N)s1 |
| InChI | InChI=1S/C7H8N6O2S2/c1-13-7(9-4(14)5(15)12-13)16-2-3-10-11-6(8)17-3/h2H2,1H3,(H2,8,11)(H,12,15) |
| InChIKey | BYTHRLYNFZQGDZ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|