C13H14BrCl2F3N2 — CID 107787989
N-(4-bromo-2,3-dichlorophenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 107787989) has the molecular formula C13H14BrCl2F3N2 and a molecular weight of 406.07 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 107787989 |
| Molecular Formula | C13H14BrCl2F3N2 |
| Molecular Weight | 406.07 g/mol |
| Exact Mass | 403.97 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | FC(F)(F)CN1CCC(Nc2ccc(Br)c(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C13H14BrCl2F3N2/c14-9-1-2-10(12(16)11(9)15)20-8-3-5-21(6-4-8)7-13(17,18)19/h1-2,8,20H,3-7H2 |
| InChIKey | AMSBGSOZYKHWOL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.07 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|