C12H13BrCl2F3N — CID 107788043
4-bromo-2,3-dichloro-N-(6,6,6-trifluorohexan-2-yl)aniline (PubChem CID 107788043) has the molecular formula C12H13BrCl2F3N and a molecular weight of 379.05 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-(6,6,6-trifluorohexan-2-yl)aniline.
| Compound Name | 4-bromo-2,3-dichloro-N-(6,6,6-trifluorohexan-2-yl)aniline |
|---|---|
| PubChem CID | 107788043 |
| Molecular Formula | C12H13BrCl2F3N |
| Molecular Weight | 379.05 g/mol |
| Exact Mass | 376.96 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-(6,6,6-trifluorohexan-2-yl)aniline |
| SMILES | CC(CCCC(F)(F)F)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C12H13BrCl2F3N/c1-7(3-2-6-12(16,17)18)19-9-5-4-8(13)10(14)11(9)15/h4-5,7,19H,2-3,6H2,1H3 |
| InChIKey | TYNWZTJHEIEZNZ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.05 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|