About N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline
N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline (PubChem CID 107788121) has the molecular formula C15H21BrCl2N2
and a molecular weight of 380.16 g/mol. Its IUPAC name is N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline.
Molecular Properties
| Compound Name | N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline |
| PubChem CID | 107788121 |
| Molecular Formula | C15H21BrCl2N2 |
| Molecular Weight | 380.16 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline |
| SMILES | CC(CC1CCCCCN1)Nc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C15H21BrCl2N2/c1-10(9-11-5-3-2-4-8-19-11)20-13-7-6-12(16)14(17)15(13)18/h6-7,10-11,19-20H,2-5,8-9H2,1H3 |
| InChIKey | IFWBRYVOLUSJOT-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.16 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline?
The IUPAC name of N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline (CID 107788121) is N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline.
What is the SMILES notation for N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline?
The canonical SMILES for N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline is CC(CC1CCCCCN1)Nc1ccc(Br)c(Cl)c1Cl.
What is the InChIKey of N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline?
The InChIKey is IFWBRYVOLUSJOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrCl2N2/c1-10(9-11-5-3-2-4-8-19-11)20-13-7-6-12(16)14(17)15(13)18/h6-7,10-11,19-20H,2-5,8-9H2,1H3.
What are the key properties of N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline?
N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline has a molecular weight of 380.16 g/mol, XLogP of 5.48, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(azepan-2-yl)propan-2-yl]-4-bromo-2,3-dichloroaniline is sourced from PubChem (CID 107788121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).