C18H28O2 — CID 10778861
2,3-dihexoxycyclohexa-1,3-dien-5-yne (PubChem CID 10778861) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2,3-dihexoxycyclohexa-1,3-dien-5-yne.
| Compound Name | 2,3-dihexoxycyclohexa-1,3-dien-5-yne |
|---|---|
| PubChem CID | 10778861 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 2,3-dihexoxycyclohexa-1,3-dien-5-yne |
| SMILES | CCCCCCOc1cc#ccc1OCCCCCC |
| InChI | InChI=1S/C18H28O2/c1-3-5-7-11-15-19-17-13-9-10-14-18(17)20-16-12-8-6-4-2/h13-14H,3-8,11-12,15-16H2,1-2H3 |
| InChIKey | ILYSAQJTGUJHRF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|