C14H9BrCl2FNO — CID 107788752
N-(4-bromo-2,3-dichlorophenyl)-4-fluoro-3-methylbenzamide (PubChem CID 107788752) has the molecular formula C14H9BrCl2FNO and a molecular weight of 377.04 g/mol. Its IUPAC name is N-(4-bromo-2,3-dichlorophenyl)-4-fluoro-3-methylbenzamide.
| Compound Name | N-(4-bromo-2,3-dichlorophenyl)-4-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 107788752 |
| Molecular Formula | C14H9BrCl2FNO |
| Molecular Weight | 377.04 g/mol |
| Exact Mass | 374.92 |
| IUPAC Name | N-(4-bromo-2,3-dichlorophenyl)-4-fluoro-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(Br)c(Cl)c2Cl)ccc1F |
| InChI | InChI=1S/C14H9BrCl2FNO/c1-7-6-8(2-4-10(7)18)14(20)19-11-5-3-9(15)12(16)13(11)17/h2-6H,1H3,(H,19,20) |
| InChIKey | NSUBLQIWDQWOLP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.04 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|