About 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline
4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline (PubChem CID 107788830) has the molecular formula C9H9BrCl2FN
and a molecular weight of 300.99 g/mol. Its IUPAC name is 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline.
Molecular Properties
| Compound Name | 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline |
| PubChem CID | 107788830 |
| Molecular Formula | C9H9BrCl2FN |
| Molecular Weight | 300.99 g/mol |
| Exact Mass | 298.93 |
| IUPAC Name | 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline |
| SMILES | FCCCNc1ccc(Br)c(Cl)c1Cl |
| InChI | InChI=1S/C9H9BrCl2FN/c10-6-2-3-7(9(12)8(6)11)14-5-1-4-13/h2-3,14H,1,4-5H2 |
| InChIKey | SPRVGYXYPGVUGO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.99 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline?
The IUPAC name of 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline (CID 107788830) is 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline.
What is the SMILES notation for 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline?
The canonical SMILES for 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline is FCCCNc1ccc(Br)c(Cl)c1Cl.
What is the InChIKey of 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline?
The InChIKey is SPRVGYXYPGVUGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrCl2FN/c10-6-2-3-7(9(12)8(6)11)14-5-1-4-13/h2-3,14H,1,4-5H2.
What are the key properties of 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline?
4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline has a molecular weight of 300.99 g/mol, XLogP of 4.53, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,3-dichloro-N-(3-fluoropropyl)aniline is sourced from PubChem (CID 107788830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).