About 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one
5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one (PubChem CID 107788861) has the molecular formula C11H11BrCl2N2O
and a molecular weight of 338.03 g/mol. Its IUPAC name is 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one |
| PubChem CID | 107788861 |
| Molecular Formula | C11H11BrCl2N2O |
| Molecular Weight | 338.03 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(CNc2ccc(Br)c(Cl)c2Cl)N1 |
| InChI | InChI=1S/C11H11BrCl2N2O/c12-7-2-3-8(11(14)10(7)13)15-5-6-1-4-9(17)16-6/h2-3,6,15H,1,4-5H2,(H,16,17) |
| InChIKey | LDRPTPDDVVKNLU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.03 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one?
The IUPAC name of 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one (CID 107788861) is 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one.
What is the SMILES notation for 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one?
The canonical SMILES for 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one is O=C1CCC(CNc2ccc(Br)c(Cl)c2Cl)N1.
What is the InChIKey of 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one?
The InChIKey is LDRPTPDDVVKNLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrCl2N2O/c12-7-2-3-8(11(14)10(7)13)15-5-6-1-4-9(17)16-6/h2-3,6,15H,1,4-5H2,(H,16,17).
What are the key properties of 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one?
5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one has a molecular weight of 338.03 g/mol, XLogP of 3.45, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one is sourced from PubChem (CID 107788861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).