C11H11BrCl2N2O — CID 107788861
5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one (PubChem CID 107788861) has the molecular formula C11H11BrCl2N2O and a molecular weight of 338.03 g/mol. Its IUPAC name is 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one.
| Compound Name | 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 107788861 |
| Molecular Formula | C11H11BrCl2N2O |
| Molecular Weight | 338.03 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | 5-[(4-bromo-2,3-dichloroanilino)methyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(CNc2ccc(Br)c(Cl)c2Cl)N1 |
| InChI | InChI=1S/C11H11BrCl2N2O/c12-7-2-3-8(11(14)10(7)13)15-5-6-1-4-9(17)16-6/h2-3,6,15H,1,4-5H2,(H,16,17) |
| InChIKey | LDRPTPDDVVKNLU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.03 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|