C11H10BrCl2F3N2O — CID 107788898
2-(4-bromo-2,3-dichloroanilino)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 107788898) has the molecular formula C11H10BrCl2F3N2O and a molecular weight of 394.02 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dichloroanilino)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-(4-bromo-2,3-dichloroanilino)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 107788898 |
| Molecular Formula | C11H10BrCl2F3N2O |
| Molecular Weight | 394.02 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 2-(4-bromo-2,3-dichloroanilino)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(Nc1ccc(Br)c(Cl)c1Cl)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H10BrCl2F3N2O/c1-5(10(20)18-4-11(15,16)17)19-7-3-2-6(12)8(13)9(7)14/h2-3,5,19H,4H2,1H3,(H,18,20) |
| InChIKey | SHXMSEUWUXQCSN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.02 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|