About 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide
2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide (PubChem CID 107788987) has the molecular formula C14H10BrCl2FN2O
and a molecular weight of 392.06 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide.
Molecular Properties
| Compound Name | 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide |
| PubChem CID | 107788987 |
| Molecular Formula | C14H10BrCl2FN2O |
| Molecular Weight | 392.06 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CNc1ccc(Br)c(Cl)c1Cl)Nc1ccccc1F |
| InChI | InChI=1S/C14H10BrCl2FN2O/c15-8-5-6-11(14(17)13(8)16)19-7-12(21)20-10-4-2-1-3-9(10)18/h1-6,19H,7H2,(H,20,21) |
| InChIKey | BMJRHBRFJDLVKI-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.06 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide?
The IUPAC name of 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide (CID 107788987) is 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide.
What is the SMILES notation for 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide?
The canonical SMILES for 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide is O=C(CNc1ccc(Br)c(Cl)c1Cl)Nc1ccccc1F.
What is the InChIKey of 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide?
The InChIKey is BMJRHBRFJDLVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrCl2FN2O/c15-8-5-6-11(14(17)13(8)16)19-7-12(21)20-10-4-2-1-3-9(10)18/h1-6,19H,7H2,(H,20,21).
What are the key properties of 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide?
2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide has a molecular weight of 392.06 g/mol, XLogP of 4.95, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-2,3-dichloroanilino)-N-(2-fluorophenyl)acetamide is sourced from PubChem (CID 107788987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).