C13H15N3O2 — CID 107789333
4-[2-(2-methoxyethoxy)ethylamino]benzene-1,2-dicarbonitrile (PubChem CID 107789333) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-[2-(2-methoxyethoxy)ethylamino]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[2-(2-methoxyethoxy)ethylamino]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107789333 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-[2-(2-methoxyethoxy)ethylamino]benzene-1,2-dicarbonitrile |
| SMILES | COCCOCCNc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C13H15N3O2/c1-17-6-7-18-5-4-16-13-3-2-11(9-14)12(8-13)10-15/h2-3,8,16H,4-7H2,1H3 |
| InChIKey | LUXOHKOAFVEZGF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|