C14H10BrIN2O2S — CID 107789533
N-(2-bromo-4-carbamothioylphenyl)-2-hydroxy-5-iodobenzamide (PubChem CID 107789533) has the molecular formula C14H10BrIN2O2S and a molecular weight of 477.12 g/mol. Its IUPAC name is N-(2-bromo-4-carbamothioylphenyl)-2-hydroxy-5-iodobenzamide.
| Compound Name | N-(2-bromo-4-carbamothioylphenyl)-2-hydroxy-5-iodobenzamide |
|---|---|
| PubChem CID | 107789533 |
| Molecular Formula | C14H10BrIN2O2S |
| Molecular Weight | 477.12 g/mol |
| Exact Mass | 475.87 |
| IUPAC Name | N-(2-bromo-4-carbamothioylphenyl)-2-hydroxy-5-iodobenzamide |
| SMILES | NC(=S)c1ccc(NC(=O)c2cc(I)ccc2O)c(Br)c1 |
| InChI | InChI=1S/C14H10BrIN2O2S/c15-10-5-7(13(17)21)1-3-11(10)18-14(20)9-6-8(16)2-4-12(9)19/h1-6,19H,(H2,17,21)(H,18,20) |
| InChIKey | NZIIQLGFAUDAFS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.12 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|