C14H22N4O2 — CID 10778980
5-methyl-1-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)pentyl]pyrimidine-2,4-dione (PubChem CID 10778980) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 5-methyl-1-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)pentyl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)pentyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10778980 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 5-methyl-1-[5-(1,4,5,6-tetrahydropyrimidin-2-yl)pentyl]pyrimidine-2,4-dione |
| SMILES | Cc1cn(CCCCCC2=NCCCN2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H22N4O2/c1-11-10-18(14(20)17-13(11)19)9-4-2-3-6-12-15-7-5-8-16-12/h10H,2-9H2,1H3,(H,15,16)(H,17,19,20) |
| InChIKey | BXKNEKVHNPLTFJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 79.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|