C12H10BrN3O3 — CID 107790543
N-[2-bromo-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]furan-3-carboxamide (PubChem CID 107790543) has the molecular formula C12H10BrN3O3 and a molecular weight of 324.13 g/mol. Its IUPAC name is N-[2-bromo-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]furan-3-carboxamide.
| Compound Name | N-[2-bromo-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 107790543 |
| Molecular Formula | C12H10BrN3O3 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | N-[2-bromo-4-[(E)-N'-hydroxycarbamimidoyl]phenyl]furan-3-carboxamide |
| SMILES | N/C(=N/O)c1ccc(NC(=O)c2ccoc2)c(Br)c1 |
| InChI | InChI=1S/C12H10BrN3O3/c13-9-5-7(11(14)16-18)1-2-10(9)15-12(17)8-3-4-19-6-8/h1-6,18H,(H2,14,16)(H,15,17) |
| InChIKey | FJEPOCXVRIENNS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|