C13H6BrCl3N2 — CID 107790842
4-(4-bromo-2,3-dichloroanilino)-2-chlorobenzonitrile (PubChem CID 107790842) has the molecular formula C13H6BrCl3N2 and a molecular weight of 376.47 g/mol. Its IUPAC name is 4-(4-bromo-2,3-dichloroanilino)-2-chlorobenzonitrile.
| Compound Name | 4-(4-bromo-2,3-dichloroanilino)-2-chlorobenzonitrile |
|---|---|
| PubChem CID | 107790842 |
| Molecular Formula | C13H6BrCl3N2 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 373.88 |
| IUPAC Name | 4-(4-bromo-2,3-dichloroanilino)-2-chlorobenzonitrile |
| SMILES | N#Cc1ccc(Nc2ccc(Br)c(Cl)c2Cl)cc1Cl |
| InChI | InChI=1S/C13H6BrCl3N2/c14-9-3-4-11(13(17)12(9)16)19-8-2-1-7(6-18)10(15)5-8/h1-5,19H |
| InChIKey | KXLLMMKLKAZMCR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|