About oct-7-ynyl 4-methylbenzenesulfonate
oct-7-ynyl 4-methylbenzenesulfonate (PubChem CID 10779145) has the molecular formula C15H20O3S
and a molecular weight of 280.39 g/mol. Its IUPAC name is oct-7-ynyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | oct-7-ynyl 4-methylbenzenesulfonate |
| PubChem CID | 10779145 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | oct-7-ynyl 4-methylbenzenesulfonate |
| SMILES | C#CCCCCCCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H20O3S/c1-3-4-5-6-7-8-13-18-19(16,17)15-11-9-14(2)10-12-15/h1,9-12H,4-8,13H2,2H3 |
| InChIKey | OJNJXLZRWIEFKZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-7-ynyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-7-ynyl 4-methylbenzenesulfonate?
The IUPAC name of oct-7-ynyl 4-methylbenzenesulfonate (CID 10779145) is oct-7-ynyl 4-methylbenzenesulfonate.
What is the SMILES notation for oct-7-ynyl 4-methylbenzenesulfonate?
The canonical SMILES for oct-7-ynyl 4-methylbenzenesulfonate is C#CCCCCCCOS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of oct-7-ynyl 4-methylbenzenesulfonate?
The InChIKey is OJNJXLZRWIEFKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3S/c1-3-4-5-6-7-8-13-18-19(16,17)15-11-9-14(2)10-12-15/h1,9-12H,4-8,13H2,2H3.
What are the key properties of oct-7-ynyl 4-methylbenzenesulfonate?
oct-7-ynyl 4-methylbenzenesulfonate has a molecular weight of 280.39 g/mol, XLogP of 3.28, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oct-7-ynyl 4-methylbenzenesulfonate is sourced from PubChem (CID 10779145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).