C10H5N5S — CID 107791467
4-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzene-1,2-dicarbonitrile (PubChem CID 107791467) has the molecular formula C10H5N5S and a molecular weight of 227.25 g/mol. Its IUPAC name is 4-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107791467 |
| Molecular Formula | C10H5N5S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-(5-sulfanylidene-1H-1,2,4-triazol-4-yl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(-n2cn[nH]c2=S)cc1C#N |
| InChI | InChI=1S/C10H5N5S/c11-4-7-1-2-9(3-8(7)5-12)15-6-13-14-10(15)16/h1-3,6H,(H,14,16) |
| InChIKey | ZYHBSEVJKWNYSI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|