C15H7BrN4S — CID 107791541
4-(6-bromo-2-sulfanylidene-3H-benzimidazol-1-yl)benzene-1,2-dicarbonitrile (PubChem CID 107791541) has the molecular formula C15H7BrN4S and a molecular weight of 355.22 g/mol. Its IUPAC name is 4-(6-bromo-2-sulfanylidene-3H-benzimidazol-1-yl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(6-bromo-2-sulfanylidene-3H-benzimidazol-1-yl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107791541 |
| Molecular Formula | C15H7BrN4S |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 353.96 |
| IUPAC Name | 4-(6-bromo-2-sulfanylidene-3H-benzimidazol-1-yl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(-n2c(=S)[nH]c3ccc(Br)cc32)cc1C#N |
| InChI | InChI=1S/C15H7BrN4S/c16-11-2-4-13-14(6-11)20(15(21)19-13)12-3-1-9(7-17)10(5-12)8-18/h1-6H,(H,19,21) |
| InChIKey | JTVFVJLARVJNJM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|