About 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile
4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile (PubChem CID 107791645) has the molecular formula C14H8N6
and a molecular weight of 260.26 g/mol. Its IUPAC name is 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile |
| PubChem CID | 107791645 |
| Molecular Formula | C14H8N6 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(-n2c(N)nc3cccnc32)cc1C#N |
| InChI | InChI=1S/C14H8N6/c15-7-9-3-4-11(6-10(9)8-16)20-13-12(19-14(20)17)2-1-5-18-13/h1-6H,(H2,17,19) |
| InChIKey | ZLMSSIKDSNBROM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile?
The IUPAC name of 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile (CID 107791645) is 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile?
The canonical SMILES for 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile is N#Cc1ccc(-n2c(N)nc3cccnc32)cc1C#N.
What is the InChIKey of 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile?
The InChIKey is ZLMSSIKDSNBROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N6/c15-7-9-3-4-11(6-10(9)8-16)20-13-12(19-14(20)17)2-1-5-18-13/h1-6H,(H2,17,19).
What are the key properties of 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile?
4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile has a molecular weight of 260.26 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoimidazo[4,5-b]pyridin-3-yl)benzene-1,2-dicarbonitrile is sourced from PubChem (CID 107791645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).