C12H13BrCl2N2O3 — CID 107791986
(2R)-2-[(4-bromo-2,3-dichlorophenyl)carbamoylamino]-3-methylbutanoic acid (PubChem CID 107791986) has the molecular formula C12H13BrCl2N2O3 and a molecular weight of 384.06 g/mol. Its IUPAC name is (2R)-2-[(4-bromo-2,3-dichlorophenyl)carbamoylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[(4-bromo-2,3-dichlorophenyl)carbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 107791986 |
| Molecular Formula | C12H13BrCl2N2O3 |
| Molecular Weight | 384.06 g/mol |
| Exact Mass | 381.95 |
| IUPAC Name | (2R)-2-[(4-bromo-2,3-dichlorophenyl)carbamoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)Nc1ccc(Br)c(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C12H13BrCl2N2O3/c1-5(2)10(11(18)19)17-12(20)16-7-4-3-6(13)8(14)9(7)15/h3-5,10H,1-2H3,(H,18,19)(H2,16,17,20)/t10-/m1/s1 |
| InChIKey | SKYXDMMLVVKZJC-SNVBAGLBSA-N |
| XLogP | 3.99 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.06 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|