C14H12N4O3 — CID 107792084
2-[(3,4-dicyanophenyl)carbamoyl-prop-2-enylamino]acetic acid (PubChem CID 107792084) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 2-[(3,4-dicyanophenyl)carbamoyl-prop-2-enylamino]acetic acid.
| Compound Name | 2-[(3,4-dicyanophenyl)carbamoyl-prop-2-enylamino]acetic acid |
|---|---|
| PubChem CID | 107792084 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-[(3,4-dicyanophenyl)carbamoyl-prop-2-enylamino]acetic acid |
| SMILES | C=CCN(CC(=O)O)C(=O)Nc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C14H12N4O3/c1-2-5-18(9-13(19)20)14(21)17-12-4-3-10(7-15)11(6-12)8-16/h2-4,6H,1,5,9H2,(H,17,21)(H,19,20) |
| InChIKey | OHXPIIUASFOIQX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|