About 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid
2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid (PubChem CID 10779234) has the molecular formula C7H4F6O5
and a molecular weight of 282.09 g/mol. Its IUPAC name is 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid |
| PubChem CID | 10779234 |
| Molecular Formula | C7H4F6O5 |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1OC(C(F)(F)F)(C(F)(F)F)OC1=O |
| InChI | InChI=1S/C7H4F6O5/c8-6(9,10)5(7(11,12)13)17-2(1-3(14)15)4(16)18-5/h2H,1H2,(H,14,15)/t2-/m0/s1 |
| InChIKey | AKAMXKBFJWZRDT-REOHCLBHSA-N |
| XLogP | 1.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid?
The IUPAC name of 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid (CID 10779234) is 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid.
What is the SMILES notation for 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid?
The canonical SMILES for 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid is O=C(O)C[C@@H]1OC(C(F)(F)F)(C(F)(F)F)OC1=O.
What is the InChIKey of 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid?
The InChIKey is AKAMXKBFJWZRDT-REOHCLBHSA-N. The full InChI is InChI=1S/C7H4F6O5/c8-6(9,10)5(7(11,12)13)17-2(1-3(14)15)4(16)18-5/h2H,1H2,(H,14,15)/t2-/m0/s1.
What are the key properties of 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid?
2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid has a molecular weight of 282.09 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-5-oxo-2,2-bis(trifluoromethyl)-1,3-dioxolan-4-yl]acetic acid is sourced from PubChem (CID 10779234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).