2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid

C14H10FNO4 — CID 107792860

IUPAC2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid
SMILESO=C(Nc1ccc(C(=O)O)c(F)c1)c1ccc(O)cc1
InChIInChI=1S/C14H10FNO4/c15-12-7-9(3-6-11(12)14(19)20)16-13(18)8-1-4-10(17)5-2-8/h1-7,17H,(H,16,18)(H,19,20)
InChIKeyCXEQJUPHXVIZTI-UHFFFAOYSA-N
MW275.24 g/mol
LogP2.48
Rot. Bonds3

About 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid

2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid (PubChem CID 107792860) has the molecular formula C14H10FNO4 and a molecular weight of 275.24 g/mol. Its IUPAC name is 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid
PubChem CID107792860
Molecular FormulaC14H10FNO4
Molecular Weight275.24 g/mol
Exact Mass275.06
IUPAC Name2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid
SMILESO=C(Nc1ccc(C(=O)O)c(F)c1)c1ccc(O)cc1
InChIInChI=1S/C14H10FNO4/c15-12-7-9(3-6-11(12)14(19)20)16-13(18)8-1-4-10(17)5-2-8/h1-7,17H,(H,16,18)(H,19,20)
InChIKeyCXEQJUPHXVIZTI-UHFFFAOYSA-N
XLogP2.48
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.24
LogP ≤ 52.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-[(3,4-difluorobenzoyl)amino]-2-fluorobenzoic acid
CID 103791546
2-fluoro-4-[(5-hydroxypyridine-3-carbonyl)amino]benzoic acid
CID 107792618
2-chloro-4-[(4-hydroxybenzoyl)amino]benzoic acid
CID 61398494
4-[(3-aminobenzoyl)amino]-2-fluorobenzoic acid
CID 103869169
4-[(5-chloro-2-fluorobenzoyl)amino]-2-fluorobenzoic acid
CID 103791493
2-fluoro-4-[(2-hydroxy-5-methylbenzoyl)amino]benzoic acid
CID 103867339
2-fluoro-4-[(3-hydroxy-2-methylbenzoyl)amino]benzoic acid
CID 107793042
2-fluoro-4-[(3-methoxybenzoyl)amino]benzoic acid
CID 103791449
N-(4-fluoro-3-methoxyphenyl)-4-hydroxybenzamide
CID 114840048
2-fluoro-4-[(2-hydroxy-3-methylbenzoyl)amino]benzoic acid
CID 103867338
2-fluoro-4-(hydroxyamino)benzoic acid
CID 142889242
2-hydroxy-4-[(4-iodobenzoyl)amino]benzoic acid
CID 28667790

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid?
The IUPAC name of 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid (CID 107792860) is 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid.
What is the SMILES notation for 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid?
The canonical SMILES for 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid is O=C(Nc1ccc(C(=O)O)c(F)c1)c1ccc(O)cc1.
What is the InChIKey of 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid?
The InChIKey is CXEQJUPHXVIZTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FNO4/c15-12-7-9(3-6-11(12)14(19)20)16-13(18)8-1-4-10(17)5-2-8/h1-7,17H,(H,16,18)(H,19,20).
What are the key properties of 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid?
2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid has a molecular weight of 275.24 g/mol, XLogP of 2.48, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-[(4-hydroxybenzoyl)amino]benzoic acid is sourced from PubChem (CID 107792860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).