C17H15N3O — CID 107793188
4-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzene-1,2-dicarbonitrile (PubChem CID 107793188) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 4-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107793188 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 4-(4-hydroxy-2-methyl-4,5,6,7-tetrahydroindol-1-yl)benzene-1,2-dicarbonitrile |
| SMILES | Cc1cc2c(n1-c1ccc(C#N)c(C#N)c1)CCCC2O |
| InChI | InChI=1S/C17H15N3O/c1-11-7-15-16(3-2-4-17(15)21)20(11)14-6-5-12(9-18)13(8-14)10-19/h5-8,17,21H,2-4H2,1H3 |
| InChIKey | SBTSPSBDKPQZNL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 72.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|