2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid

C10H7FN2O2S — CID 107793421

IUPAC2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid
SMILESO=C(O)c1ccc(Nc2nccs2)cc1F
InChIInChI=1S/C10H7FN2O2S/c11-8-5-6(1-2-7(8)9(14)15)13-10-12-3-4-16-10/h1-5H,(H,12,13)(H,14,15)
InChIKeyPBWKJVXSTLIJRV-UHFFFAOYSA-N
MW238.24 g/mol
LogP2.72
Rot. Bonds3

About 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid

2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid (PubChem CID 107793421) has the molecular formula C10H7FN2O2S and a molecular weight of 238.24 g/mol. Its IUPAC name is 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid.

Molecular Properties

Compound Name2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid
PubChem CID107793421
Molecular FormulaC10H7FN2O2S
Molecular Weight238.24 g/mol
Exact Mass238.02
IUPAC Name2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid
SMILESO=C(O)c1ccc(Nc2nccs2)cc1F
InChIInChI=1S/C10H7FN2O2S/c11-8-5-6(1-2-7(8)9(14)15)13-10-12-3-4-16-10/h1-5H,(H,12,13)(H,14,15)
InChIKeyPBWKJVXSTLIJRV-UHFFFAOYSA-N
XLogP2.72
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.24
LogP ≤ 52.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid?
The IUPAC name of 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid (CID 107793421) is 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid.
What is the SMILES notation for 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid?
The canonical SMILES for 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid is O=C(O)c1ccc(Nc2nccs2)cc1F.
What is the InChIKey of 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid?
The InChIKey is PBWKJVXSTLIJRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2O2S/c11-8-5-6(1-2-7(8)9(14)15)13-10-12-3-4-16-10/h1-5H,(H,12,13)(H,14,15).
What are the key properties of 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid?
2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid has a molecular weight of 238.24 g/mol, XLogP of 2.72, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(1,3-thiazol-2-ylamino)benzoic acid is sourced from PubChem (CID 107793421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).