C15H13BrN4O — CID 107793713
N-(2-bromo-4-cyanophenyl)-2-methyl-6-(methylamino)pyridine-4-carboxamide (PubChem CID 107793713) has the molecular formula C15H13BrN4O and a molecular weight of 345.20 g/mol. Its IUPAC name is N-(2-bromo-4-cyanophenyl)-2-methyl-6-(methylamino)pyridine-4-carboxamide.
| Compound Name | N-(2-bromo-4-cyanophenyl)-2-methyl-6-(methylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 107793713 |
| Molecular Formula | C15H13BrN4O |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | N-(2-bromo-4-cyanophenyl)-2-methyl-6-(methylamino)pyridine-4-carboxamide |
| SMILES | CNc1cc(C(=O)Nc2ccc(C#N)cc2Br)cc(C)n1 |
| InChI | InChI=1S/C15H13BrN4O/c1-9-5-11(7-14(18-2)19-9)15(21)20-13-4-3-10(8-17)6-12(13)16/h3-7H,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | XUYMMWLFNRLBJS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |