About 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione
4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione (PubChem CID 107794209) has the molecular formula C10H7BrCl2N2O2
and a molecular weight of 337.99 g/mol. Its IUPAC name is 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione.
Molecular Properties
| Compound Name | 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione |
| PubChem CID | 107794209 |
| Molecular Formula | C10H7BrCl2N2O2 |
| Molecular Weight | 337.99 g/mol |
| Exact Mass | 335.91 |
| IUPAC Name | 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione |
| SMILES | O=C1CN(c2ccc(Br)c(Cl)c2Cl)CC(=O)N1 |
| InChI | InChI=1S/C10H7BrCl2N2O2/c11-5-1-2-6(10(13)9(5)12)15-3-7(16)14-8(17)4-15/h1-2H,3-4H2,(H,14,16,17) |
| InChIKey | DOXKEZJFDVNRMJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.99 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione?
The IUPAC name of 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione (CID 107794209) is 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione.
What is the SMILES notation for 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione?
The canonical SMILES for 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione is O=C1CN(c2ccc(Br)c(Cl)c2Cl)CC(=O)N1.
What is the InChIKey of 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione?
The InChIKey is DOXKEZJFDVNRMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrCl2N2O2/c11-5-1-2-6(10(13)9(5)12)15-3-7(16)14-8(17)4-15/h1-2H,3-4H2,(H,14,16,17).
What are the key properties of 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione?
4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione has a molecular weight of 337.99 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromo-2,3-dichlorophenyl)piperazine-2,6-dione is sourced from PubChem (CID 107794209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).