About 6-bromo-7,8-dichloroquinolin-2-amine
6-bromo-7,8-dichloroquinolin-2-amine (PubChem CID 107794242) has the molecular formula C9H5BrCl2N2
and a molecular weight of 291.96 g/mol. Its IUPAC name is 6-bromo-7,8-dichloroquinolin-2-amine.
Molecular Properties
| Compound Name | 6-bromo-7,8-dichloroquinolin-2-amine |
| PubChem CID | 107794242 |
| Molecular Formula | C9H5BrCl2N2 |
| Molecular Weight | 291.96 g/mol |
| Exact Mass | 289.90 |
| IUPAC Name | 6-bromo-7,8-dichloroquinolin-2-amine |
| SMILES | Nc1ccc2cc(Br)c(Cl)c(Cl)c2n1 |
| InChI | InChI=1S/C9H5BrCl2N2/c10-5-3-4-1-2-6(13)14-9(4)8(12)7(5)11/h1-3H,(H2,13,14) |
| InChIKey | UKYINDDWAQCOFF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-7,8-dichloroquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7,8-dichloroquinolin-2-amine?
The IUPAC name of 6-bromo-7,8-dichloroquinolin-2-amine (CID 107794242) is 6-bromo-7,8-dichloroquinolin-2-amine.
What is the SMILES notation for 6-bromo-7,8-dichloroquinolin-2-amine?
The canonical SMILES for 6-bromo-7,8-dichloroquinolin-2-amine is Nc1ccc2cc(Br)c(Cl)c(Cl)c2n1.
What is the InChIKey of 6-bromo-7,8-dichloroquinolin-2-amine?
The InChIKey is UKYINDDWAQCOFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5BrCl2N2/c10-5-3-4-1-2-6(13)14-9(4)8(12)7(5)11/h1-3H,(H2,13,14).
What are the key properties of 6-bromo-7,8-dichloroquinolin-2-amine?
6-bromo-7,8-dichloroquinolin-2-amine has a molecular weight of 291.96 g/mol, XLogP of 3.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7,8-dichloroquinolin-2-amine is sourced from PubChem (CID 107794242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).