C15H24O3S — CID 10779438
3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,2,4,4-tetramethylpentan-3-ol (PubChem CID 10779438) has the molecular formula C15H24O3S and a molecular weight of 284.42 g/mol. Its IUPAC name is 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,2,4,4-tetramethylpentan-3-ol.
| Compound Name | 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,2,4,4-tetramethylpentan-3-ol |
|---|---|
| PubChem CID | 10779438 |
| Molecular Formula | C15H24O3S |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,2,4,4-tetramethylpentan-3-ol |
| SMILES | CC(C)(C)C(O)(c1scc2c1OCCO2)C(C)(C)C |
| InChI | InChI=1S/C15H24O3S/c1-13(2,3)15(16,14(4,5)6)12-11-10(9-19-12)17-7-8-18-11/h9,16H,7-8H2,1-6H3 |
| InChIKey | MPPMBXCFKXMXAH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |