C14H10F4O2 — CID 10779540
6-(2,2,3,3-tetrafluoropropoxy)naphthalene-2-carbaldehyde (PubChem CID 10779540) has the molecular formula C14H10F4O2 and a molecular weight of 286.22 g/mol. Its IUPAC name is 6-(2,2,3,3-tetrafluoropropoxy)naphthalene-2-carbaldehyde.
| Compound Name | 6-(2,2,3,3-tetrafluoropropoxy)naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 10779540 |
| Molecular Formula | C14H10F4O2 |
| Molecular Weight | 286.22 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 6-(2,2,3,3-tetrafluoropropoxy)naphthalene-2-carbaldehyde |
| SMILES | O=Cc1ccc2cc(OCC(F)(F)C(F)F)ccc2c1 |
| InChI | InChI=1S/C14H10F4O2/c15-13(16)14(17,18)8-20-12-4-3-10-5-9(7-19)1-2-11(10)6-12/h1-7,13H,8H2 |
| InChIKey | LVMQRJZOGXSXTJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|