C12H14FN3O2 — CID 107795654
4-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-3-fluoroaniline (PubChem CID 107795654) has the molecular formula C12H14FN3O2 and a molecular weight of 251.26 g/mol. Its IUPAC name is 4-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-3-fluoroaniline.
| Compound Name | 4-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-3-fluoroaniline |
|---|---|
| PubChem CID | 107795654 |
| Molecular Formula | C12H14FN3O2 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4-[3-(2-ethoxyethyl)-1,2,4-oxadiazol-5-yl]-3-fluoroaniline |
| SMILES | CCOCCc1noc(-c2ccc(N)cc2F)n1 |
| InChI | InChI=1S/C12H14FN3O2/c1-2-17-6-5-11-15-12(18-16-11)9-4-3-8(14)7-10(9)13/h3-4,7H,2,5-6,14H2,1H3 |
| InChIKey | OJZYEVXBAYYXCK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|