C13H26N4O3 — CID 10779584
7-(1,3-dioxolan-2-ylmethyl)-1,4,7,10-tetrazacyclododecane-1-carbaldehyde (PubChem CID 10779584) has the molecular formula C13H26N4O3 and a molecular weight of 286.38 g/mol. Its IUPAC name is 7-(1,3-dioxolan-2-ylmethyl)-1,4,7,10-tetrazacyclododecane-1-carbaldehyde.
| Compound Name | 7-(1,3-dioxolan-2-ylmethyl)-1,4,7,10-tetrazacyclododecane-1-carbaldehyde |
|---|---|
| PubChem CID | 10779584 |
| Molecular Formula | C13H26N4O3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 7-(1,3-dioxolan-2-ylmethyl)-1,4,7,10-tetrazacyclododecane-1-carbaldehyde |
| SMILES | O=CN1CCNCCN(CC2OCCO2)CCNCC1 |
| InChI | InChI=1S/C13H26N4O3/c18-12-17-7-3-14-1-5-16(6-2-15-4-8-17)11-13-19-9-10-20-13/h12-15H,1-11H2 |
| InChIKey | WCBCUNDARKMAIL-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|