C16H11N3O2 — CID 107796103
4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzene-1,2-dicarbonitrile (PubChem CID 107796103) has the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 107796103 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(N2C(=O)[C@H]3CC=CC[C@H]3C2=O)cc1C#N |
| InChI | InChI=1S/C16H11N3O2/c17-8-10-5-6-12(7-11(10)9-18)19-15(20)13-3-1-2-4-14(13)16(19)21/h1-2,5-7,13-14H,3-4H2/t13-,14+ |
| InChIKey | GJQKPZWQCQDBHX-OKILXGFUSA-N |
| XLogP | 1.89 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|